Definder - what does the word mean?

What is ozone layer?

A Layer That Earth🌍 Had 100M Yrs Ago
Jake: The Ozone Layer Is Big! I hope I get there
Drake: First You Need A Rocket And 100,000 Oil

Ozone Layers Are A O2 Part

πŸ‘25 πŸ‘Ž11


ozone layer - video

loading

Ozone layer - what is it?

ozone layer is made by 3 oxygen element.Ozone layer is capable of blocking UVB(harmful UV ray).However,chlorofluorocarbons(CFCs) is depleting the ozone layer.CFCs can takes up to 8 years to reach the atmosphere.Once there,it will start breaking up ozone molecule and more UV ray(UVB) penetrate to the Earth.
As a result,people get cataract whih will lead to blindness,skin cancer which might peel off ur skin.

The ozone layer, or ozonosphere layer (rarely used term), is the part of the Earth's concentrations of ozone (O3).

πŸ‘61 πŸ‘Ž21