|
|||||
What is Ozone layer?A Layer That Earthπ Had 100M Yrs Ago Ozone Layers Are A O2 Part Ozone layer - videoOzone layer - what is it?ozone layer is made by 3 oxygen element.Ozone layer is capable of blocking UVB(harmful UV ray).However,chlorofluorocarbons(CFCs) is depleting the ozone layer.CFCs can takes up to 8 years to reach the atmosphere.Once there,it will start breaking up ozone molecule and more UV ray(UVB) penetrate to the Earth. The ozone layer, or ozonosphere layer (rarely used term), is the part of the Earth's concentrations of ozone (O3). |
|||||
www.Definder.net Powered by Urban Dictionary |